For research use only. Not for therapeutic Use.
Disperse Blue 124 (Cat No.:R044545) is a synthetic organic dye classified as a disperse dye. Disperse dyes are specifically designed for coloring synthetic hydrophobic fibers, such as polyester, acetate, and nylon, due to their limited solubility in water. Disperse Blue 124 is known for its vibrant blue color and is commonly used in the textile industry to dye synthetic fabrics. The dyeing process typically involves heating the dye and fabric together, allowing the dye molecules to disperse and adhere to the polyester fibers. Disperse Blue 124 contributes to the production of colorful and fade-resistant synthetic textiles used in clothing, home furnishings, and other applications.
| CAS Number | 15141-18-1 |
| Synonyms | 2-[Ethyl[3-methyl-4-[2-(5-nitro-2-thiazolyl)diazenyl]phenyl]amino]-ethanol 1-Acetate; 2-[N-Ethyl-4-[(5-nitro-2-thiazolyl)azo]-m-toluidino]-ethanol Acetate(ester); 2-[Ethyl[3-methyl-4-[(5-nitro-2-thiazolyl)azo]phenyl]amino]-ethanol Acetate(ester); C.I |
| Molecular Formula | C16H19N5O4S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[N-ethyl-3-methyl-4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]anilino]ethyl acetate |
| InChI | InChI=1S/C16H19N5O4S/c1-4-20(7-8-25-12(3)22)13-5-6-14(11(2)9-13)18-19-16-17-10-15(26-16)21(23)24/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | HMAJVAFLGGPIPN-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)C)C1=CC(=C(C=C1)N=NC2=NC=C(S2)[N+](=O)[O-])C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |