For research use only. Not for therapeutic Use.
Diphenyltin Dichloride (Cat.No:R025662) is an organotin compound used in organic synthesis and as a precursor for various tin-containing materials. It has been explored for its potential applications in catalysis and as a reagent in chemical reactions. Diphenyltin Dichloride plays a role in diverse research and industrial processes.
| CAS Number | 1135-99-5 |
| Synonyms | Dichlorobis(phenyl)tin; Dichlorodiphenylstannane; Dichlorodiphenyltin; Diphenyldichlorotin; Diphenylstannyl Dichloride; Diphenyltin Chloride; NSC 405640 |
| Molecular Formula | C12H10Cl2Sn |
| Purity | ≥95% |
| Target | MDM-2/p53 |
| Storage | 2°C to 8°C |
| IUPAC Name | dichloro(diphenyl)stannane |
| InChI | InChI=1S/2C6H5.2ClH.Sn/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ISXUHJXWYNONDI-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
