For research use only. Not for therapeutic Use.
Diphenylphosphinic Acid Phenyl Ester is an organophosphorus compound used primarily in organic synthesis and chemical research. Its structure consists of a diphenylphosphinic acid core bonded to a phenyl ester, making it a valuable reagent in the preparation of phosphorus-containing compounds. It is commonly utilized in catalysis, polymer chemistry, and the development of flame retardants. Additionally, it plays a role in pharmaceutical research, aiding in the synthesis of bioactive molecules and other functionalized compounds for advanced material studies.
| CAS Number | 1706-96-3 |
| Synonyms | Diphenylphosphinic acid phenyl ester |
| Molecular Formula | C18H15O2P |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | diphenylphosphoryloxybenzene |
| InChI | InChI=1S/C18H15O2P/c19-21(17-12-6-2-7-13-17,18-14-8-3-9-15-18)20-16-10-4-1-5-11-16/h1-15H |
| InChIKey | CIJWIJSYZZLMGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OP(=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |