Diphenylamine is an aromatic amine widely used as an antioxidant in the rubber and plastics industries to prevent degradation caused by exposure to heat, oxygen, and light. It inhibits the formation of free radicals, extending the lifespan of these materials. Additionally, diphenylamine finds applications in the production of dyes, pharmaceuticals, and pesticides, showcasing its versatility in various industrial sectors.
Catalog Number | R042584 |
CAS Number | 122-39-4 |
Synonyms | N-Phenylbenzenamine; Diphenylamine; Anilinobenzene; (Phenylamino)benzene; DBA; DFA; DPA; N,N-Diphenylamine; N-Phenylaniline; N-Phenylbenzenamine; NSC 215210; Naugalube 428L; No-Scald |
Molecular Formula | C12H11N |
Purity | 95% |
Storage | Desiccate at RT |
IUPAC Name | N-phenylaniline |
InChI | InChI=1S/C12H11N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10,13H |
InChIKey | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |