For research use only. Not for therapeutic Use.
Diphenyl phthalate-3,4,5,6-d4（Cat No.:I045015）is a deuterated form of diphenyl phthalate in which four hydrogen atoms on the aromatic ring are replaced with deuterium (^2H or D), enhancing its utility in mass spectrometry and environmental fate studies. This stable isotope-labeled compound is commonly used as an internal standard in analytical chemistry, especially in detecting phthalate esters in plastics and environmental samples. Its molecular formula is C₁₆H₆D₄O₄, and it maintains the physicochemical properties of the parent compound while allowing for precise isotopic differentiation in complex matrices.
| CAS Number | 1398065-61-6 |
| Synonyms | diphenyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| Molecular Formula | C20H10D4O4 |
| Purity | ≥95% |
| IUPAC Name | diphenyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChI | InChI=1S/C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16/h1-14H/i7D,8D,13D,14D |
| InChIKey | DWNAQMUDCDVSLT-ZZRPVTOQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OC2=CC=CC=C2)C(=O)OC3=CC=CC=C3)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
