Diphencyprone (CAT: I006492), also known as diphencypron or diphencyprone, is a synthetic compound that belongs to the class of immunomodulators. It is primarily used in dermatology for the treatment of skin conditions such as alopecia areata and warts. Diphencyprone works by stimulating the immune system and promoting an inflammatory response in the treated area. This immune response helps to target and destroy abnormal or diseased cells, such as those causing hair loss in alopecia areata or the human papillomavirus (HPV) in warts. Diphencyprone is typically applied topically as a solution or cream and requires careful application and monitoring by a healthcare professional due to its immunomodulatory effects.
| Catalog Number | I006492 |
| CAS Number | 886-38-4 |
| Synonyms | Diphencyprone; DPCP and Diphenylcyclopropenone,;2,3-Diphenylcycloprop-2-en-1-one |
| Molecular Formula | C15H10O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| Overview of Clinical Research | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”color:#000000;”><span style=”font-size:12px;”>Diphencyprone acts as an immunomodulator. It has been granted its orphan drug status in m<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>alignant melanoma.</span></span></span></span> |
| IUPAC Name | 2,3-diphenylcycloprop-2-en-1-one |
| InChI | InChI=1S/C15H10O/c16-15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | HCIBTBXNLVOFER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C2=O)C3=CC=CC=C3 |
| Reference | <br /> |
