For research use only. Not for therapeutic Use.
Diosmetin 7-O-β-D-glucuronide（Cat No.:I018375）is a flavonoid glucuronide metabolite derived from diosmetin, a natural flavone present in citrus fruits and medicinal plants. This conjugated form enhances solubility and influences bioavailability, making it a key compound in metabolism, pharmacokinetics, and bioactivity studies. Research highlights its potential antioxidant, anti-inflammatory, and vascular-protective effects, with relevance in cardiovascular and metabolic disease investigations. As a purified reference standard, Diosmetin 7-O-β-D-glucuronide is valuable in phytochemistry, pharmacology, and nutraceutical development, supporting studies of flavonoid metabolism and the therapeutic potential of plant-derived conjugated metabolites.
| CAS Number | 35110-20-4 |
| Synonyms | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
| Molecular Formula | C22H20O12 |
| Purity | ≥95% |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C22H20O12/c1-31-13-3-2-8(4-10(13)23)14-7-12(25)16-11(24)5-9(6-15(16)33-14)32-22-19(28)17(26)18(27)20(34-22)21(29)30/h2-7,17-20,22-24,26-28H,1H3,(H,29,30)/t17-,18-,19+,20-,22+/m0/s1 |
| InChIKey | XCKMDTYMOHXUHG-SXFAUFNYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
