For research use only. Not for therapeutic Use.
Dioctyldiphenylamine（Cat No.:M070523）is an aromatic amine antioxidant composed of two phenyl groups bonded to a central nitrogen atom, which is further substituted with two octyl chains. This lipophilic structure imparts excellent solubility in nonpolar media and provides oxidative stability in various industrial applications. It is primarily used as an antioxidant in lubricants, greases, and rubber formulations to prevent thermal degradation and oxidative aging. Its high-temperature stability makes it valuable in automotive and industrial oils. Dioctyldiphenylamine effectively scavenges free radicals, extending the lifespan and performance of materials exposed to heat and oxygen.
| CAS Number | 101-67-7 |
| Molecular Formula | C28H43N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-octyl-N-(4-octylphenyl)aniline |
| InChI | InChI=1S/C28H43N/c1-3-5-7-9-11-13-15-25-17-21-27(22-18-25)29-28-23-19-26(20-24-28)16-14-12-10-8-6-4-2/h17-24,29H,3-16H2,1-2H3 |
| InChIKey | QAPVYZRWKDXNDK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=CC=C(C=C1)NC2=CC=C(C=C2)CCCCCCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
