For research use only. Not for therapeutic Use.
Dioctyl sebacate (Cat No.: M070030) is a clear, oily liquid ester formed from sebacic acid and 2-ethylhexanol. Known for its excellent low-temperature flexibility, high thermal stability, and compatibility with various polymers, DOS is widely used as a plasticizer in PVC, synthetic rubbers, and other flexible materials. It enhances softness, durability, and resistance to cold cracking. Additionally, it serves in lubricants, hydraulic fluids, and personal care formulations. Its non-volatile, non-toxic nature makes it suitable for sensitive applications including food packaging and medical devices.
| CAS Number | 122-62-3 |
| Molecular Formula | C26H50O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | bis(2-ethylhexyl) decanedioate |
| InChI | InChI=1S/C26H50O4/c1-5-9-17-23(7-3)21-29-25(27)19-15-13-11-12-14-16-20-26(28)30-22-24(8-4)18-10-6-2/h23-24H,5-22H2,1-4H3 |
| InChIKey | VJHINFRRDQUWOJ-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
