For research use only. Not for therapeutic Use.
Dinotefuran(Cat No.:I002161)is a broad-spectrum neonicotinoid insecticide used to control various pests, including ants, fleas, and termites. It acts as an agonist at nicotinic acetylcholine receptors, disrupting insect neural activity, leading to paralysis and death. With its systemic action, Dinotefuran is absorbed by plants and provides long-lasting protection against pests. It is often used in agriculture, residential pest control, and veterinary medicine, especially in flea treatments for pets. Its relatively low toxicity to humans and animals makes it a favorable choice in integrated pest management strategies.
| CAS Number | 165252-70-0 |
| Molecular Formula | C7H14N4O3 |
| Purity | ≥95% |
| Target | Membrane Transporter/Ion Channel |
| Solubility | H2O: 39.83 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 1-methyl-2-nitro-3-(oxolan-3-ylmethyl)guanidine |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YKBZOVFACRVRJN-UHFFFAOYSA-N |
| SMILES | CN/C(=N\[N+](=O)[O-])/NCC1CCOC1 |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |