Dimethylsulfoniopropionate (DMSP) is a sulfur-containing compound produced primarily by marine algae and some bacteria and plants. It plays a crucial role in the global sulfur cycle, acting as a major precursor to the climate-cooling gas dimethyl sulfide (DMS). DMSP also serves as an osmoprotectant, helping organisms cope with environmental stress such as high salinity. Its breakdown into DMS influences cloud formation and, consequently, the Earth’s climate, making it a significant focus in ecological and atmospheric studies.
| Catalog Number | R059528 |
| CAS Number | 7314-30-9 |
| Synonyms | (2-Carboxyethyl)dimethylsulfonium Hydroxide Inner Salt; 3-Dimethylsulfoniopropionate; DMSP; Dimethyl-3-propiothetin; Dimethyl-β-propiothetin; Dimethylpropiothetin; Dimethylsulfoniopropionate; Dimethylsulphonioproprionate; β-Dimethylsulfoniopropionic |
| Molecular Formula | (CH3)2S(+)CH2CH2COO(-) |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-dimethylsulfoniopropanoate |
| InChI | InChI=1S/C5H10O2S/c1-8(2)4-3-5(6)7/h3-4H2,1-2H3 |
| InChIKey | DFPOZTRSOAQFIK-UHFFFAOYSA-N |
| SMILES | C[S+](C)CCC(=O)[O-] |
