For research use only. Not for therapeutic Use.
Dimethylpropiothetin hydrochloride-d6 (Cat No.:I041484) is a deuterated form of dimethylpropiothetin hydrochloride, where six hydrogen atoms are replaced by deuterium. This compound is often used as an isotopic tracer in metabolic studies, allowing for precise analysis through mass spectrometry or NMR spectroscopy. Its deuterated nature makes it useful in pharmacokinetic research, particularly for tracking drug absorption and metabolism. Dimethylpropiothetin hydrochloride-d6 is also applied in the synthesis of deuterated bioactive molecules, facilitating research in drug discovery, enzymatic reactions, and biochemical pathways involving sulfur-containing compounds.
| CAS Number | 1246274-70-3 |
| Synonyms | 2-carboxyethyl-bis(trideuteriomethyl)sulfanium;chloride |
| Molecular Formula | C5H5D6ClO2S |
| Purity | ≥95% |
| IUPAC Name | 2-carboxyethyl-bis(trideuteriomethyl)sulfanium;chloride |
| InChI | InChI=1S/C5H10O2S.ClH/c1-8(2)4-3-5(6)7;/h3-4H2,1-2H3;1H/i1D3,2D3; |
| InChIKey | RRUMKKGRKSSZKY-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])[S+](CCC(=O)O)C([2H])([2H])[2H].[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |