For research use only. Not for therapeutic Use.
({[(Dimethylamino)methylidene]amino})(Cat No.:L007375), is a compound of interest in organic chemistry. Its structure includes a dimethylamino group (N(CH3)2) attached to a methylene group (CH2) with an imine (C=N) functional group. Compounds containing imines have diverse applications, ranging from intermediates in organic synthesis to ligands in coordination chemistry. Imines play a crucial role in the formation of amines, amines, and other nitrogen-containing compounds. Researchers often explore their reactivity to create complex molecules and study their biological activities.
| CAS Number | 20353-93-9 |
| Molecular Formula | C6H14ClN3 |
| Purity | ≥95% |
| IUPAC Name | bis(dimethylaminomethylidene)azanium;chloride |
| InChI | InChI=1S/C6H14N3.ClH/c1-8(2)5-7-6-9(3)4;/h5-6H,1-4H3;1H/q+1;/p-1 |
| InChIKey | DEIBXAPEZDJDRC-UHFFFAOYSA-M |
| SMILES | CN(C)C=[N+]=CN(C)C.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |