For research use only. Not for therapeutic Use.
Dimethyl succinate-d4(Cat No.:I044700)is a deuterated form of dimethyl succinate, in which four hydrogen atoms on the methylene groups are replaced with deuterium (²H or D). This stable isotope-labeled compound is primarily used in metabolic studies, tracer experiments, and analytical chemistry, especially in NMR spectroscopy and mass spectrometry. Its deuterium incorporation allows for precise tracking of metabolic pathways involving succinate in the tricarboxylic acid (TCA) cycle. Additionally, it serves as an internal standard in quantitative analysis. Dimethyl succinate-d4 retains the chemical reactivity of its non-deuterated counterpart while providing distinct isotopic labeling advantages.
CAS Number | 30994-23-1 |
Synonyms | dimethyl 2,2,3,3-tetradeuteriobutanedioate |
Molecular Formula | C6H6D4O4 |
Purity | ≥95% |
IUPAC Name | dimethyl 2,2,3,3-tetradeuteriobutanedioate |
InChI | InChI=1S/C6H10O4/c1-9-5(7)3-4-6(8)10-2/h3-4H2,1-2H3/i3D2,4D2 |
InChIKey | MUXOBHXGJLMRAB-KHORGVISSA-N |
SMILES | [2H]C([2H])(C(=O)OC)C([2H])([2H])C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |