For research use only. Not for therapeutic Use.
Dimethyl octadecanedioate (Cat No.: M049543) is a diester compound derived from octadecanedioic acid, a long-chain C18 dicarboxylic acid, with methyl ester groups at both ends. It appears as a waxy solid or viscous liquid and is used in the synthesis of polymers, plasticizers, and lubricants due to its flexibility, hydrophobicity, and chemical stability. Its structure provides good thermal and oxidative resistance, making it suitable for cosmetic formulations, biodegradable materials, and industrial applications requiring long-chain aliphatic compounds with dual ester functionality.
| CAS Number | 1472-93-1 |
| Molecular Formula | C20H38O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | dimethyl octadecanedioate |
| InChI | InChI=1S/C20H38O4/c1-23-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)24-2/h3-18H2,1-2H3 |
| InChIKey | ZOXMHKCFDXHCJX-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCCCCCCCCCCCC(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
