For research use only. Not for therapeutic Use.
Dimethyl 5-bromoisophthalate(Cat No.:L013867)is a brominated aromatic diester featuring a benzene ring substituted with a bromine atom at the 5-position and two methyl ester groups at the 1 and 3 positions. This compound serves as a key intermediate in organic synthesis, particularly in the preparation of specialty polymers, pharmaceuticals, and agrochemicals. The bromine atom enables cross-coupling reactions like Suzuki or Heck, while the ester groups allow for further derivatization. Its symmetrical structure and functional versatility make it ideal for constructing complex molecules, dendrimers, and advanced materials with tailored electronic or mechanical properties.
| CAS Number | 51760-21-5 |
| Molecular Formula | C10H9BrO4 |
| Purity | ≥95% |
| IUPAC Name | dimethyl 5-bromobenzene-1,3-dicarboxylate |
| InChI | InChI=1S/C10H9BrO4/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5H,1-2H3 |
| InChIKey | QUJINGKSNJNXEB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |