For research use only. Not for therapeutic Use.
Dihydropalmatine（Cat No.:I017930）is a natural isoquinoline alkaloid found in plants such as Corydalis and Stephania species, traditionally used in Chinese herbal medicine. It exhibits analgesic, sedative, and anxiolytic properties through modulation of dopaminergic, serotonergic, and GABAergic neurotransmission. Dihydropalmatine has been studied for potential use in pain management, insomnia, and drug addiction therapy due to its ability to reduce cravings and withdrawal symptoms. Additionally, it shows cardiovascular and neuroprotective effects. As a bioactive natural compound, dihydropalmatine is a valuable candidate for pharmacological and therapeutic research in neurology and psychiatry.
| CAS Number | 26067-60-7 |
| Synonyms | 2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinoline |
| Molecular Formula | C21H23NO4 |
| Purity | ≥95% |
| IUPAC Name | 2,3,9,10-tetramethoxy-6,8-dihydro-5H-isoquinolino[2,1-b]isoquinoline |
| InChI | InChI=1S/C21H23NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-11H,7-8,12H2,1-4H3 |
| InChIKey | PTPHDVKWAYIFRX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=C3C4=CC(=C(C=C4CCN3C2)OC)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
