For research use only. Not for therapeutic Use.
Dihydrolycorine（Cat No.:R072485）is an isoquinoline alkaloid derivative found in Lycoris species, plants traditionally used in Asian herbal medicine. It exhibits notable pharmacological activities, including anti-inflammatory, neuroprotective, and anticancer effects. Mechanistically, dihydrolycorine has been reported to modulate signaling pathways such as NF-κB, PI3K/Akt, and apoptosis-related cascades, thereby suppressing inflammation, protecting neurons, and inhibiting tumor cell proliferation. Preclinical studies suggest potential applications in treating neurological disorders, inflammatory conditions, and certain cancers. As a bioactive natural alkaloid, dihydrolycorine serves as an important lead compound for pharmacological and therapeutic research.
| CAS Number | 6271-21-2 |
| Synonyms | (1S,15R,17S,18S,19R)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-17,18-diol |
| Molecular Formula | C16H19NO4 |
| Purity | ≥95% |
| IUPAC Name | (1S,15R,17S,18S,19R)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9-triene-17,18-diol |
| InChI | InChI=1S/C16H19NO4/c18-11-3-8-1-2-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19/h4-5,8,11,14-16,18-19H,1-3,6-7H2/t8-,11+,14+,15-,16-/m1/s1 |
| InChIKey | VJILFEGOWCJNIK-MGRBZGILSA-N |
| SMILES | C1CN2CC3=CC4=C(C=C3[C@H]5[C@H]2[C@H]1C[C@@H]([C@H]5O)O)OCO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
