For research use only. Not for therapeutic Use.
Dihydrolapachenole（Cat No.:M209890）is a naturally occurring naphthoquinone derivative, typically isolated from plants in the Tecoma or Tabebuia genera. Structurally, it is a reduced form of lapachenole, featuring a dihydronaphthoquinone core that contributes to its redox activity and biological effects. Dihydrolapachenole has demonstrated antimicrobial, anti-inflammatory, and cytotoxic properties in early studies, making it a compound of interest in natural product research. Its ability to interfere with cellular redox balance and modulate enzyme activity suggests potential applications in cancer therapy, infectious disease treatment, and the development of plant-based therapeutic agents.
| CAS Number | 20213-26-7 |
| Synonyms | 6-methoxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromene |
| Molecular Formula | C16H18O2 |
| Purity | ≥95% |
| IUPAC Name | 6-methoxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromene |
| InChI | InChI=1S/C16H18O2/c1-16(2)9-8-11-10-14(17-3)12-6-4-5-7-13(12)15(11)18-16/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | OZVDAMFCGBFOHR-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C3=CC=CC=C3C(=C2)OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
