For research use only. Not for therapeutic Use.
Dihydroevocarpine(Cat No.:R050946)is an alkaloid compound primarily isolated from the fruit of Evodia rutaecarpa, a traditional medicinal plant used in East Asian herbal medicine. It belongs to the indole alkaloid class and exhibits diverse pharmacological properties, including anti-inflammatory, analgesic, and potential neuroprotective effects. Dihydroevocarpine has been shown to modulate neurotransmitter systems and inhibit pro-inflammatory cytokines, supporting its role in pain relief and inflammation regulation. Its bioactive structure contributes to its therapeutic relevance in treating headaches, gastrointestinal discomfort, and inflammatory conditions, making it a candidate for further research in natural drug development.
CAS Number | 15266-35-0 |
Synonyms | 1-methyl-2-tridecylquinolin-4-one |
Molecular Formula | C23H35NO |
Purity | ≥95% |
IUPAC Name | 1-methyl-2-tridecylquinolin-4-one |
InChI | InChI=1S/C23H35NO/c1-3-4-5-6-7-8-9-10-11-12-13-16-20-19-23(25)21-17-14-15-18-22(21)24(20)2/h14-15,17-19H,3-13,16H2,1-2H3 |
InChIKey | DWHCRAGHDDLXEM-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCC1=CC(=O)C2=CC=CC=C2N1C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |