For research use only. Not for therapeutic Use.
Digitolutein (Cat No.: I042502) is a naturally occurring cardiac glycoside belonging to the cardenolide family, structurally related to digoxin and digitoxin. It exerts its effects by inhibiting the Na⁺/K⁺-ATPase pump, leading to increased intracellular calcium levels and enhanced cardiac contractility. Digitolutein is primarily studied for its cardiotonic properties and potential anticancer effects due to its ability to induce apoptosis in tumor cells. Though less commonly used clinically, it is valuable in pharmacological research focused on heart failure and oncology drug development.
| CAS Number | 477-86-1 |
| Synonyms | 2-hydroxy-1-methoxy-3-methylanthracene-9,10-dione |
| Molecular Formula | C16H12O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H12O4/c1-8-7-11-12(16(20-2)13(8)17)15(19)10-6-4-3-5-9(10)14(11)18/h3-7,17H,1-2H3 |
| InChIKey | WCRMDMYSQWZTSF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)OC)C(=O)C3=CC=CC=C3C2=O |
| Reference | [1]. Koumaglo K, et al. Effects of three compounds extracted from Morinda lucida on Plasmodium falciparum. Planta Med. 1992 Dec;58(6):533-4. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
