For research use only. Not for therapeutic Use.
Difamilast(CAT: I026115) is a chemical compound that has garnered attention in pharmaceutical and medicinal chemistry. It belongs to a class of compounds known as phosphodiesterase 4 (PDE4) inhibitors. Difamilast specifically targets PDE4 enzymes, which are involved in the regulation of inflammatory responses. This makes it a potential candidate for the treatment of inflammatory diseases, such as chronic obstructive pulmonary disease (COPD) and psoriasis.
| Catalog Number | I026115 |
| CAS Number | 937782-05-3 |
| Synonyms | Difamilast; |
| Molecular Formula | C23H24F2N2O5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | N-({2-[4-(difluoromethoxy)-3-(propan-2-yloxy)phenyl]-1,3-oxazol-4-yl}methyl)-2-ethoxybenzamide |
| InChI | InChI=1S/C23H24F2N2O5/c1-4-29-18-8-6-5-7-17(18)21(28)26-12-16-13-30-22(27-16)15-9-10-19(32-23(24)25)20(11-15)31-14(2)3/h5-11,13-14,23H,4,12H2,1-3H3,(H,26,28) |
| InChIKey | VFBILHPIHUPBPZ-UHFFFAOYSA-N |
| SMILES | O=C(NCC1=COC(C2=CC=C(OC(F)F)C(OC(C)C)=C2)=N1)C3=CC=CC=C3OCC |
