For research use only. Not for therapeutic Use.
Diethyl Phthalate (Cat.No:R050350) is a colorless and odorless liquid commonly used as a plasticizer in various industrial applications. It imparts flexibility and durability to plastics, making it crucial in the production of consumer goods. Additionally, it finds use in cosmetics, personal care products, and as a solvent in various industries.
CAS Number | 84-66-2 |
Synonyms | 1,2-Benzenedicarboxylic Acid 1,2-Diethyl Ester; 1,2-Benzenedicarboxylic Acid Diethyl Ester; Phthalic Acid Diethyl Ester; Anozol; DEP; Diethyl 1,2-Benzenedicarboxylate; Diethyl Phthalate; Ethyl Phthalate; NSC 8905; Neantine; Palatinol A; Phthalol; Pla |
Molecular Formula | C6H4(COOC2H5)2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | diethyl benzene-1,2-dicarboxylate |
InChI | InChI=1S/C12H14O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-8H,3-4H2,1-2H3 |
InChIKey | FLKPEMZONWLCSK-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC=CC=C1C(=O)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |