For research use only. Not for therapeutic Use.
Diethyl Malonate-13C2(Cat No.:R016128)is a high-purity isotopically labeled compound essential for advanced pharmaceutical and chemical research. Featuring two carbon-13 atoms, this labeled version of diethyl malonate is crucial for studying reaction mechanisms, metabolic pathways, and synthetic chemistry processes. It enhances the precision and accuracy of analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for drug development, organic synthesis, and metabolic research, Diethyl Malonate-13C2 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 77386-82-4 |
Synonyms | Propanedioic-1,3-13C2 Acid Diethyl Ester |
Molecular Formula | C7H12O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | diethyl (1,3-13C2)propanedioate |
InChI | InChI=1S/C7H12O4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3/i6+1,7+1 |
InChIKey | IYXGSMUGOJNHAZ-AKZCFXPHSA-N |
SMILES | CCO[13C](=O)C[13C](=O)OCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |