Diethyl carbonate(Cat No.:R018481), is an organic compound that serves various industrial and chemical purposes. It is a clear, colorless liquid with a fruity odor and is commonly used as a solvent in chemical processes, particularly in the production of pharmaceuticals, perfumes, and plastics. Diethyl carbonate also has applications as an electrolyte component in lithium-ion batteries and as a reactant in the synthesis of organic compounds.
Catalog Number | R018481 |
CAS Number | 105-58-8 |
Synonyms | DEC; Diatol; Diatol (Carbonate); Diethyl Carbonate; Diethyl Ester Carbonic Acid; Ethyl Carbonate; Ethyl Carbonate ((EtO)2CO); Eufin; H-DEC; NSC 8849; |
Molecular Formula | C5H10O3 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | diethyl carbonate |
InChI | InChI=1S/C5H10O3/c1-3-7-5(6)8-4-2/h3-4H2,1-2H3 |
InChIKey | OIFBSDVPJOWBCH-UHFFFAOYSA-N |
SMILES | CCOC(=O)OCC |