For research use only. Not for therapeutic Use.
Diethyl 2-aminomalonate hydrochloride(Cat No.:R025540)is a versatile chemical intermediate with the molecular formula C7H14ClNO4. It consists of a diethyl ester of aminomalonic acid combined with hydrochloride, enhancing its stability and solubility. This compound is widely used in pharmaceutical and agrochemical synthesis, particularly in the preparation of α-amino acids, heterocycles, and peptidomimetics. Its reactive amine and ester groups enable diverse functionalization, making it an essential building block in organic synthesis. Diethyl 2-aminomalonate hydrochloride is valued for its efficiency in constructing complex nitrogen-containing molecular frameworks.
| CAS Number | 13433-00-6 |
| Synonyms | 2-Aminopropanedioic Acid 1,3-Diethyl Ester Hydrochloride; Aminopropanedioic Acid Diethyl Ester Hydrochloride; 2-Aminomalonic Acid Diethyl Ester Hydrochloride; Aminomalonic Acid Diethyl Ester Hydrochloride; Diethyl Aminomalonate Hydrochloride; Diethyl |
| Molecular Formula | C7H14ClNO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | diethyl 2-aminopropanedioate;hydrochloride |
| InChI | InChI=1S/C7H13NO4.ClH/c1-3-11-6(9)5(8)7(10)12-4-2;/h5H,3-4,8H2,1-2H3;1H |
| InChIKey | GLFVNTDRBTZJIY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |