For research use only. Not for therapeutic Use.
Dicyclohexylamine 2,2-dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oate is a complex organic compound featuring a dicyclohexylamine group attached to a bicyclic ester structure containing a nitrogen atom, oxyethylene linkages, and a carbonyl group. The compound’s unique structure combines elements of cyclic amides and ethers, making it potentially useful as a surfactant, stabilizer, or intermediate in the synthesis of larger molecules. It could have applications in pharmaceutical formulations, materials science, or catalysis due to its functional groups and molecular flexibility.
| CAS Number | 560088-79-1 |
| Molecular Formula | C23H44N2O6 |
| Purity | ≥95% |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
| InChI | InChI=1S/C12H23N.C11H21NO6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-11(2,3)18-10(15)12-4-5-16-6-7-17-8-9(13)14/h11-13H,1-10H2;4-8H2,1-3H3,(H,12,15)(H,13,14) |
| InChIKey | SWUXEYKTUQROOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC(=O)O.C1CCC(CC1)NC2CCCCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |