For research use only. Not for therapeutic Use.
Dichotomitin（Cat No.:R072482）is a secondary metabolite isolated from marine-derived fungi, particularly Dichotomomyces species. Classified as an indole alkaloid, it exhibits diverse biological activities, including cytotoxic, antimicrobial, and anti-inflammatory effects. Its structural complexity contributes to potent interactions with cellular targets, making it of interest in natural product chemistry and drug discovery. Studies suggest that dichotomitin may inhibit tumor cell growth and modulate immune responses, highlighting potential applications in oncology and infectious disease research. As a marine fungal metabolite, it underscores the ocean’s role as a source of novel bioactive compounds.
| CAS Number | 88509-91-5 |
| Synonyms | 9-hydroxy-7-(3-hydroxy-4,5-dimethoxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |
| Molecular Formula | C18H14O8 |
| Purity | ≥95% |
| IUPAC Name | 9-hydroxy-7-(3-hydroxy-4,5-dimethoxyphenyl)-[1,3]dioxolo[4,5-g]chromen-8-one |
| InChI | InChI=1S/C18H14O8/c1-22-12-4-8(3-10(19)17(12)23-2)9-6-24-11-5-13-18(26-7-25-13)16(21)14(11)15(9)20/h3-6,19,21H,7H2,1-2H3 |
| InChIKey | PFFOGGCBLWTCPM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)O)C2=COC3=CC4=C(C(=C3C2=O)O)OCO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
