For research use only. Not for therapeutic Use.
Dichotomine B（Cat No.:I043644）is a naturally occurring peptide isolated from the Dichotomous genus of fungi. Known for its unique chemical structure, it has attracted attention in biomedical research due to its potential bioactive properties. Preliminary studies suggest it may exhibit anti-inflammatory, antimicrobial, and anticancer effects, although further research is needed to fully understand its therapeutic potential. Dichotomine B’s specific mechanism of action is still under investigation, but it shows promise in drug discovery, especially for treating infections and inflammation-related disorders. Its role in metabolic diseases is also being explored.
| CAS Number | 755036-41-0 |
| Synonyms | 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| Molecular Formula | C14H12N2O4 |
| Purity | ≥95% |
| IUPAC Name | 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChI | InChI=1S/C14H12N2O4/c17-6-11(18)13-12-8(5-10(16-13)14(19)20)7-3-1-2-4-9(7)15-12/h1-5,11,15,17-18H,6H2,(H,19,20)/t11-/m0/s1 |
| InChIKey | PKSXEHHRROSXPR-NSHDSACASA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)[C@H](CO)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
