Dichloro N, N-diisopropyl phosphoramidite （Cat No.:R002285） is a phosphoramidite compound used in the synthesis of DNA and RNA oligonucleotides in the field of molecular biology. It is commonly used as a phosphorylating agent in the phosphoramidite method of oligonucleotide synthesis, where it is reacted with nucleoside bases to form phosphoramidite derivatives. These derivatives are then coupled with solid-phase-bound nucleotide residues to extend the oligonucleotide chain. The dichloro N, N-diisopropyl phosphoramidite reagent facilitates the precise and efficient synthesis of oligonucleotides with defined sequences, making it a valuable tool in genetic research, diagnostics, and therapeutic applications.
| Catalog Number | R002285 |
| CAS Number | 921-26-6 |
| Synonyms | Diisopropylaminophosphordichloride;?Diisopropylphosphoramidous Dichloride; |
| Molecular Formula | C6H14Cl2NP |
| Purity | 0% |
| Storage | Store at -20°C |
| IUPAC Name | N-dichlorophosphanyl-N-propan-2-ylpropan-2-amine |
| InChI | InChI=1S/C6H14Cl2NP/c1-5(2)9(6(3)4)10(7)8/h5-6H,1-4H3 |
| InChIKey | UPPVRFOGRCBSJP-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)P(Cl)Cl |
