For research use only. Not for therapeutic Use.
Dichloro(dicyclopentadienyl)platinum(II) (Cat No.: M051863) is an organometallic compound featuring a platinum(II) center coordinated to two cyclopentadienyl (Cp) ligands and two chloride ions. It is a notable example of a metallocene derivative, where the Cp rings stabilize the metal center, enhancing its reactivity and electronic properties. This compound is of interest in catalysis, materials science, and organometallic research. Its unique structure supports studies in metal-ligand interactions, and it may serve as a precursor for synthesizing novel platinum-containing complexes with potential applications in catalysis and electronic materials.
| CAS Number | 12083-92-0 |
| Molecular Formula | C10H12Cl2Pt |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | C1C2C=[C-]C1C3C2C=C[CH-]3.Cl[Pt+2]Cl |
| InChI | InChI=1S/C10H10.2ClH.Pt/c1-2-9-7-4-5-8(6-7)10(9)3-1;;;/h1-4,7-10H,6H2;2*1H;/q-2;;;+4/p-2 |
| InChIKey | RWZWORGWYUIYOP-UHFFFAOYSA-L |
| SMILES | C1C2C=[C-]C1C3C2C=C[CH-]3.Cl[Pt+2]Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |