For research use only. Not for therapeutic Use.
Dichlormid（Cat No.:R069379）is a selective herbicide safener widely used in agriculture to protect crops, particularly corn, from potential phytotoxicity caused by thiocarbamate and chloroacetanilide herbicides. It functions by enhancing the detoxification pathways in plants, increasing their tolerance to herbicidal stress without reducing weed-control efficacy. Researchers employ Dichlormid in agrochemical studies to investigate plant–herbicide interactions, metabolic resistance mechanisms, and crop protection strategies. Its ability to selectively shield crops makes it a valuable tool in sustainable agriculture, herbicide formulation development, and environmental safety assessments.
| CAS Number | 37764-25-3 |
| Synonyms | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide |
| Molecular Formula | C8H11Cl2NO |
| Purity | ≥95% |
| IUPAC Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide |
| InChI | InChI=1S/C8H11Cl2NO/c1-3-5-11(6-4-2)8(12)7(9)10/h3-4,7H,1-2,5-6H2 |
| InChIKey | YRMLFORXOOIJDR-UHFFFAOYSA-N |
| SMILES | C=CCN(CC=C)C(=O)C(Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
