For research use only. Not for therapeutic Use.
Dicentrine（Cat No.:R072467） is an aporphine alkaloid naturally occurring in plants of the Lauraceae family. It is widely studied for its diverse pharmacological activities, including anti-inflammatory, antioxidant, vasorelaxant, and anticancer effects. Dicentrine has been shown to inhibit tumor cell proliferation, modulate calcium channels, and influence vascular smooth muscle responses, making it valuable in cardiovascular and oncology research. Its alkaloid structure provides important insights into natural product chemistry and structure–activity relationships. Dicentrine is applied in pharmacological studies, drug discovery, and investigations of plant-derived bioactive compounds.
| CAS Number | 517-66-8 |
| Synonyms | (12S)-16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene |
| Molecular Formula | C20H21NO4 |
| Purity | ≥95% |
| IUPAC Name | (12S)-16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene |
| InChI | InChI=1S/C20H21NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1 |
| InChIKey | YJWBWQWUHVXPNC-AWEZNQCLSA-N |
| SMILES | CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
