Dibutylboryl trifluoromethanesulfonate solution is a reagent used in organic synthesis, particularly in the formation of carbon-carbon and carbon-heteroatom bonds. It combines the properties of dibutylborane with the highly reactive trifluoromethanesulfonate group. This solution is often employed in cross-coupling reactions, facilitating the creation of complex molecules. Its utility in synthesizing pharmaceuticals, agrochemicals, and advanced materials makes it a valuable tool for chemists in various fields of research and industrial applications.
| Catalog Number | R045084 |
| CAS Number | 60669-69-4 |
| Synonyms | 1,1,1-Trifluoromethanesulfonic Acid Anhydride with B,B-Dibutylborinic Acid; Trifluoromethanesulfonic Acid Anhydride with Dibutylborinic Acid; Bu2BOTf; Di-n-butylboron Triflate; Dibutyl(trifluoromethylsulfonyloxy)borane; Dibutylboron Triflate; |
| Molecular Formula | C9H18BF3O3S |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | dibutylboranyl trifluoromethanesulfonate |
| InChI | InChI=1S/C9H18BF3O3S/c1-3-5-7-10(8-6-4-2)16-17(14,15)9(11,12)13/h3-8H2,1-2H3 |
| InChIKey | FAVAVMFXAKZTMV-UHFFFAOYSA-N |
| SMILES | B(CCCC)(CCCC)OS(=O)(=O)C(F)(F)F |
