For research use only. Not for therapeutic Use.
Dibromoacetaldehyde(Cat No.:R063982)is a highly reactive halogenated aldehyde characterized by two bromine atoms attached to the alpha carbon of an aldehyde group. It is primarily used as a synthetic intermediate in organic and medicinal chemistry, particularly in the formation of heterocycles, halogenated building blocks, and bioactive molecules. Its electron-withdrawing bromine substituents enhance electrophilicity, enabling diverse transformations such as nucleophilic addition, condensation, and cyclization reactions. Due to its reactivity, dibromoacetaldehyde must be handled under controlled conditions, making it suitable for advanced synthesis in fine chemical and pharmaceutical development.
| CAS Number | 3039-13-2 |
| Synonyms | Dibromo-acetaldehyde |
| Molecular Formula | C2H2Br2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,2-dibromoacetaldehyde |
| InChI | InChI=1S/C2H2Br2O/c3-2(4)1-5/h1-2H |
| InChIKey | XIVPMNIFAAGBOY-UHFFFAOYSA-N |
| SMILES | C(=O)C(Br)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |