For research use only. Not for therapeutic Use.
Dibenz[b,e]oxepin-11(6H)-one(Cat No.:R010657)is a tricyclic aromatic compound featuring a dibenzo-fused oxepin ring with a ketone functional group at the 11-position. The structure combines two benzene rings and a seven-membered oxygen-containing heterocycle, contributing to its rigidity and planar geometry. This compound serves as a key scaffold in medicinal chemistry, particularly in the development of central nervous system (CNS) agents such as antidepressants and antipsychotics. The ketone group enables further functionalization, making it a useful intermediate for synthesizing derivatives with bioactivity or materials properties in pharmaceutical and organic chemistry research.
| CAS Number | 4504-87-4 |
| Synonyms | 6,11-Dihydrodibenz[b,e]oxepin-11-one; Doxepin Related Compound A; |
| Molecular Formula | C14H10O2 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | 6H-benzo[c][1]benzoxepin-11-one |
| InChI | InChI=1S/C14H10O2/c15-14-11-6-2-1-5-10(11)9-16-13-8-4-3-7-12(13)14/h1-8H,9H2 |
| InChIKey | YUSHFLBKQQILNV-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)C3=CC=CC=C3O1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |