Di-n-butylmagnesium (Cat No.:M047859) is an organomagnesium compound characterized by the presence of two n-butyl groups attached to a central magnesium atom. This substance belongs to the class of Grignard reagents, which are widely used in organic synthesis for forming carbon-carbon bonds. Di-n-butylmagnesium is a highly reactive material, typically handled in solution form under inert atmosphere conditions to prevent reactions with atmospheric moisture and oxygen. It is used primarily for the synthesis of complex organic molecules, serving as a strong nucleophile that can add to a variety of electrophilic centers.
| Catalog Number | M047859 |
| CAS Number | 1191-47-5 |
| Molecular Formula | C8H18Mg |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | magnesium;butane |
| InChI | InChI=1S/2C4H9.Mg/c2*1-3-4-2;/h2*1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | KJJBSBKRXUVBMX-UHFFFAOYSA-N |
| SMILES | CCC[CH2-].CCC[CH2-].[Mg+2] |
