For research use only. Not for therapeutic Use.
Di-n-butyl zinc (Cat No.:M046411) is an organometallic compound consisting of zinc and n-butyl groups. It is primarily used as a reagent in organic synthesis, particularly in the formation of carbon-carbon and carbon-heteroatom bonds. Di-n-butyl zinc is part of a class of compounds known as organozinc reagents, which are versatile intermediates in chemical reactions. They are employed in processes such as the Negishi coupling and Kumada coupling, which are important in the synthesis of pharmaceuticals and complex organic molecules. These reagents enable the creation of specific chemical structures, making them valuable tools in organic chemistry research and the pharmaceutical industry.
CAS Number | 1119-90-0 |
Molecular Formula | C8H18Zn |
Purity | ≥95% |
Storage | Desiccate at -20°C |
IUPAC Name | zinc;butane |
InChI | InChI=1S/2C4H9.Zn/c2*1-3-4-2;/h2*1,3-4H2,2H3;/q2*-1;+2 |
InChIKey | HEPBQSXQJMTVFI-UHFFFAOYSA-N |
SMILES | CCC[CH2-].CCC[CH2-].[Zn+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |