For research use only. Not for therapeutic Use.
Dexmecamylamine HCl(CAT: I006447) is a potent and selective nicotinic acetylcholine receptor (nAChR) antagonist, primarily targeting neuronal nAChRs. By inhibiting these receptors, it effectively modulates cholinergic neurotransmission, reducing neuronal excitability and synaptic transmission. This mechanism makes Dexmecamylamine HCl valuable in neurological research, particularly in studying neurodegenerative diseases and cognitive disorders. Its ability to influence the central nervous system positions it within the Neurology pharmaceutical field. Dexmecamylamine HCl serves as a critical tool for exploring therapeutic strategies in conditions like Alzheimer’s disease, schizophrenia, and nicotine addiction, supporting advanced neurological research and drug development.
CAS Number | 107596-30-5 |
Synonyms | TC-5214; TC 5214; TC5214; NIH-11008; NIH 11008; NIH11008; Dexmecamylamine; Dexmecamylamine HCl;(1R,2S,4S)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine hydrochloride |
Molecular Formula | C11H22ClN |
Purity | ≥95% |
Target | nicotinic channel modulator |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4°C for short term or -20 °C for long term |
IUPAC Name | (1S,3S,4R)-N,2,2,3-tetramethylbicyclo[2.2.1]heptan-3-amine;hydrochloride |
InChI | InChI=1S/C11H21N.ClH/c1-10(2)8-5-6-9(7-8)11(10,3)12-4;/h8-9,12H,5-7H2,1-4H3;1H/t8-,9+,11-;/m0./s1 |
InChIKey | PKVZBNCYEICAQP-GSTSRXQZSA-N |
SMILES | CC1(C2CCC(C2)C1(C)NC)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |