For research use only. Not for therapeutic Use.
Deximafen (Cat.No:I025976) is a non-steroidal anti-inflammatory drug (NSAID) with analgesic and anti-inflammatory properties. It is commonly used to alleviate pain and reduce inflammation associated with conditions such as rheumatoid arthritis and osteoarthritis. Deximafen works by inhibiting the synthesis of prostaglandins, thereby relieving pain and swelling.
| CAS Number | 42116-77-8 |
| Synonyms | Deximafen; R 25540; R-25540; R25540; |
| Molecular Formula | C11H13N3 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 5-phenyl-2,3,5,6-tetrahydro-1H-imidazo[1,2-a]imidazole |
| InChI | InChI=1S/C11H13N3/c1-2-4-9(5-3-1)10-8-13-11-12-6-7-14(10)11/h1-5,10H,6-8H2,(H,12,13) |
| InChIKey | VVLJQSJNPKNTAT-UHFFFAOYSA-N |
| SMILES | C1CN2C(CN=C2N1)C3=CC=CC=C3 |
| Reference | 1: Gasiorowska I, Młynarczyk A. [Clinical and bacteriological evaluation of the |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |