For research use only. Not for therapeutic Use.
Dexamethasone dipropionate is a potent corticosteroid medication primarily used to reduce inflammation and suppress the immune system. It’s effective in treating various inflammatory and autoimmune conditions, such as severe allergies, skin diseases, asthma, and certain types of arthritis. Available in different forms, including topical creams and injections, it provides relief by decreasing the body’s inflammatory response. Due to its strength, it’s typically prescribed for short-term use to minimize potential side effects.
| CAS Number | 55541-30-5 |
| Synonyms | (11β,16α)-9-Fluoro-11-hydroxy-16-methyl-17,21-bis(1-oxopropoxy)-pregna-1,4-diene-3,20-dione; Dexamethasone 17,21-Dipropionate; Methaderm; |
| Molecular Formula | C28H37FO7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| InChI | InChI=1S/C28H37FO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19+,20+,21+,25+,26+,27+,28+/m1/s1 |
| InChIKey | CIWBQSYVNNPZIQ-PKWREOPISA-N |
| SMILES | CCC(=O)OCC(=O)C1(C(CC2C1(CC(C3(C2CCC4=CC(=O)C=CC43C)F)O)C)C)OC(=O)CC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |