For research use only. Not for therapeutic Use.
Despropionyl meta-fluorofentanyl (Cat.No: R066709) is an analytical reference standard that is structurally similar to known opioids. It is a potential impurity found in the synthesis of meta-fluorofentanyl and meta-fluorobutyryl fentanyl. This product is intended for research and forensic applications.
| CAS Number | 416881-38-4 |
| Synonyms | Despropionyl 3-FF;Despropionyl m-FF;Despropionyl 3-Fluorofentanyl;Despropionyl m-Fluorofentanyl |
| Molecular Formula | C19H23FN2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(3-fluorophenyl)-1-(2-phenylethyl)piperidin-4-amine |
| InChI | InChI=1S/C19H23FN2/c20-17-7-4-8-19(15-17)21-18-10-13-22(14-11-18)12-9-16-5-2-1-3-6-16/h1-8,15,18,21H,9-14H2 |
| InChIKey | NDGQTNDWAZPEQV-UHFFFAOYSA-N |
| SMILES | FC1=CC=CC(NC2CCN(CCC3=CC=CC=C3)CC2)=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |