For research use only. Not for therapeutic Use.
Deoxyelephantopin(Cat No.:R055267)is a sesquiterpene lactone primarily isolated from Elephantopus species, plants traditionally used in herbal medicine. Structurally, it contains germacranolide skeletons with reactive α-methylene-γ-lactone groups, which contribute to its potent bioactivity. Deoxyelephantopin has been extensively studied for anticancer, anti-inflammatory, and antimicrobial properties. It can induce apoptosis, inhibit NF-κB signaling, and modulate oxidative stress pathways, making it a promising lead compound in oncology research. Additionally, it shows potential in regulating immune responses and infection control. As a natural product, deoxyelephantopin is valuable in pharmacological and therapeutic development.
CAS Number | 29307-03-7 |
Synonyms | [(3S,4R,8R,9E,12S)-10-methyl-5-methylidene-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),9-dien-3-yl] 2-methylprop-2-enoate |
Molecular Formula | C19H20O6 |
Purity | ≥95% |
IUPAC Name | [(3S,4R,8R,9E,12R)-10-methyl-5-methylidene-6,14-dioxo-7,13-dioxatricyclo[10.2.1.04,8]pentadeca-1(15),9-dien-3-yl] 2-methylprop-2-enoate |
InChI | InChI=1S/C19H20O6/c1-9(2)17(20)24-15-8-12-7-13(23-19(12)22)5-10(3)6-14-16(15)11(4)18(21)25-14/h6-7,13-16H,1,4-5,8H2,2-3H3/b10-6+/t13-,14-,15+,16+/m1/s1 |
InChIKey | JMUOPRSXUVOHFE-GZZMZBIISA-N |
SMILES | C/C/1=C\[C@@H]2[C@@H]([C@H](CC3=C[C@@H](C1)OC3=O)OC(=O)C(=C)C)C(=C)C(=O)O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |