Home
>
Inhibitors/Agonists>Cell Cycle>Nucleoside Antimetabolite/Analog>
>
Deoxy-5-methylcytidylic acid
Deoxy-5-methylcytidylic acid(Cat No.:L037849)is a methylated nucleotide derivative of deoxycytidylic acid, where a methyl group is added to the cytosine base at the 5-position. This modification plays a key role in epigenetic regulation, particularly in DNA methylation, a process essential for controlling gene expression, DNA repair, and chromatin structure. Deoxy-5-methylcytidylic acid is widely studied in epigenetics research for its involvement in gene silencing, genomic imprinting, and the development of diseases such as cancer. Its presence in DNA contributes to the understanding of methylation patterns and their biological implications.
Catalog Number | L037849 |
CAS Number | 2498-41-1 |
Molecular Formula | C10H16N3O7P |
Purity | ≥95% |
IUPAC Name | [(2R,3S,5R)-5-(4-amino-5-methyl-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
InChI | InChI=1S/C10H16N3O7P/c1-5-3-13(10(15)12-9(5)11)8-2-6(14)7(20-8)4-19-21(16,17)18/h3,6-8,14H,2,4H2,1H3,(H2,11,12,15)(H2,16,17,18)/t6-,7+,8+/m0/s1 |
InChIKey | RGDVNLHBCKWZDA-XLPZGREQSA-N |
SMILES | CC1=CN(C(=O)N=C1N)[C@H]2C[C@@H]([C@H](O2)COP(=O)(O)O)O |