For research use only. Not for therapeutic Use.
(-)-Denudatin B（Cat No.:R015671）is a naturally occurring diterpenoid alkaloid primarily isolated from Aconitum species, plants traditionally used in East Asian medicine. It features a complex polycyclic structure typical of C19-diterpenoid alkaloids and exhibits notable pharmacological properties. (-)-Denudatin B has been studied for its potential analgesic, anti-inflammatory, and neuroactive effects, likely mediated through modulation of ion channels and neurotransmitter systems. Due to its structural similarity to other bioactive Aconitum alkaloids, it is also being evaluated for toxicity and therapeutic potential. Its complex chemistry makes it a subject of interest in natural product and medicinal research.
| CAS Number | 87402-88-8 |
| Synonyms | (2S,3R,3aR)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| Molecular Formula | C21H24O5 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,3aR)-2-(3,4-dimethoxyphenyl)-3a-methoxy-3-methyl-5-prop-2-enyl-2,3-dihydro-1-benzofuran-6-one |
| InChI | InChI=1S/C21H24O5/c1-6-7-15-12-21(25-5)13(2)20(26-19(21)11-16(15)22)14-8-9-17(23-3)18(10-14)24-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+,21-/m1/s1 |
| InChIKey | VDYACOATPFOZIO-HBUDHLSFSA-N |
| SMILES | C[C@@H]1[C@H](OC2=CC(=O)C(=C[C@@]12OC)CC=C)C3=CC(=C(C=C3)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
