For research use only. Not for therapeutic Use.
Demethylwedelolactone (Cat No.:R072478) is a naturally occurring coumestan derivative primarily isolated from Eclipta prostrata, a medicinal herb used in traditional Asian therapies. It demonstrates diverse pharmacological activities, including hepatoprotective, anti-inflammatory, antioxidant, and anticancer effects. DWL has been studied for its ability to modulate NF-κB and MAPK signaling pathways, suppress pro-inflammatory cytokines, and protect against oxidative stress–induced cellular injury. In cancer research, it shows potential in inhibiting tumor cell proliferation and inducing apoptosis. With its multifunctional bioactivity, Demethylwedelolactone holds promise as a therapeutic lead for liver and inflammatory disorders.
| CAS Number | 6468-55-9 |
| Synonyms | 1,3,8,9-tetrahydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| Molecular Formula | C15H8O7 |
| Purity | ≥95% |
| IUPAC Name | 1,3,8,9-tetrahydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| InChI | InChI=1S/C15H8O7/c16-5-1-9(19)13-11(2-5)22-15(20)12-6-3-7(17)8(18)4-10(6)21-14(12)13/h1-4,16-19H |
| InChIKey | LUTYTNLPIUCKBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1O)C3=C(C4=CC(=C(C=C4O3)O)O)C(=O)O2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
