For research use only. Not for therapeutic Use.
Delphinidin-3-O-galactoside chloride(Cat No.:I044925)is an anthocyanin compound commonly found in berries such as blueberries and bilberries. It consists of the delphinidin aglycone bound to a galactose sugar at the 3-position, with the chloride form enhancing its stability for research use. This compound is known for its vibrant blue-purple pigmentation and potent antioxidant properties. Delphinidin-3-O-galactoside chloride plays a significant role in protecting cells from oxidative stress, reducing inflammation, and supporting cardiovascular and neuroprotective health. It is widely studied in nutraceutical, cosmetic, and functional food research for its therapeutic and visual benefits.
CAS Number | 28500-00-7 |
Synonyms | (2S,3R,4S,5R,6R)-2-[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol;chloride |
Molecular Formula | C21H21ClO12 |
Purity | ≥95% |
IUPAC Name | (2S,3R,4S,5R,6R)-2-[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol;chloride |
InChI | InChI=1S/C21H20O12.ClH/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7;/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27);1H/t15-,17+,18+,19-,21-;/m1./s1 |
InChIKey | ZJWIIMLSNZOCBP-KGDMUXNNSA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C2=[O+]C3=CC(=CC(=C3C=C2O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O)O)O.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |