For research use only. Not for therapeutic Use.
Dehydroglyasperin C（Cat No.:R015220）is a prenylated flavonoid isolated from Glycyrrhiza species (licorice root), known for its diverse pharmacological properties. It exhibits potent antioxidant, anti-inflammatory, and anticancer activities, making it a subject of interest in natural product research. Dehydroglyasperin C modulates key signaling pathways such as NF-κB and MAPK, contributing to its ability to suppress pro-inflammatory cytokines and inhibit tumor cell proliferation. Its lipophilic prenyl group enhances cellular uptake and bioactivity. This compound shows promise for therapeutic development in metabolic, inflammatory, and oncological conditions, supporting its value in functional food and medicinal research.
| CAS Number | 199331-35-6 |
| Synonyms | 4-[7-hydroxy-5-methoxy-6-(3-methylbut-2-enyl)-2H-chromen-3-yl]benzene-1,3-diol |
| Molecular Formula | C21H22O5 |
| Purity | ≥95% |
| IUPAC Name | 4-[7-hydroxy-5-methoxy-6-(3-methylbut-2-enyl)-2H-chromen-3-yl]benzene-1,3-diol |
| InChI | InChI=1S/C21H22O5/c1-12(2)4-6-16-19(24)10-20-17(21(16)25-3)8-13(11-26-20)15-7-5-14(22)9-18(15)23/h4-5,7-10,22-24H,6,11H2,1-3H3 |
| InChIKey | UACNRZUVCUEUPY-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OCC(=C2)C3=C(C=C(C=C3)O)O)OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
