For research use only. Not for therapeutic Use.
<p style=/line-height:25px/>Dehydrocholic acid (Cat.No:I004953) is a synthetic bile acid, manufactured by the oxidation of cholic acid. Dehydrocholic acid acts as a hydrocholeretic, increasing bile output to clear increased bile acid load.</p>
| CAS Number | 81-23-2 |
| Molecular Formula | C24H34O5 |
| Purity | ≥95% |
| Target | Microorganisms |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20℃ |
| IUPAC Name | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| InChI | InChI=1S/C24H34O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,22H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,22+,23+,24-/m1/s1 |
| InChIKey | OHXPGWPVLFPUSM-KLRNGDHRSA-N |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |