For research use only. Not for therapeutic Use.
Dehydro Bisoprolol (Cat.No:R012675) is a chemical compound with potential pharmaceutical applications. It is a derivative of Bisoprolol, a beta-blocker used in the treatment of hypertension and heart-related conditions. Dehydro Bisoprolol may exhibit unique pharmacological properties, making it valuable in the development of novel therapeutic agents.
| CAS Number | 1217245-60-7 |
| Synonyms | 3-[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]-N-(1-methylethyl)-2-propen-1-amine; ? |
| Molecular Formula | C18H29NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (E)-N-propan-2-yl-3-[4-(2-propan-2-yloxyethoxymethyl)phenoxy]prop-2-en-1-amine |
| InChI | InChI=1S/C18H29NO3/c1-15(2)19-10-5-11-22-18-8-6-17(7-9-18)14-20-12-13-21-16(3)4/h5-9,11,15-16,19H,10,12-14H2,1-4H3/b11-5+ |
| InChIKey | JZRKUNUKKCUCNI-VZUCSPMQSA-N |
| SMILES | CC(C)NCC=COC1=CC=C(C=C1)COCCOC(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
